C25H38N2O2 — CID 55692324
N-[1-(4-butylcyclohexanecarbonyl)piperidin-4-yl]-3-phenylpropanamide (PubChem CID 55692324) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[1-(4-butylcyclohexanecarbonyl)piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-(4-butylcyclohexanecarbonyl)piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55692324 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N-[1-(4-butylcyclohexanecarbonyl)piperidin-4-yl]-3-phenylpropanamide |
| SMILES | CCCCC1CCC(C(=O)N2CCC(NC(=O)CCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C25H38N2O2/c1-2-3-7-21-10-13-22(14-11-21)25(29)27-18-16-23(17-19-27)26-24(28)15-12-20-8-5-4-6-9-20/h4-6,8-9,21-23H,2-3,7,10-19H2,1H3,(H,26,28) |
| InChIKey | KODGFTMOOTZDHJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |