C22H21NO3S2 — CID 71808743
[4-(benzenesulfonyl)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone (PubChem CID 71808743) has the molecular formula C22H21NO3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 71808743 |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [4-(benzenesulfonyl)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccsc2)cc1)N1CCC(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H21NO3S2/c24-22(18-8-6-17(7-9-18)19-12-15-27-16-19)23-13-10-21(11-14-23)28(25,26)20-4-2-1-3-5-20/h1-9,12,15-16,21H,10-11,13-14H2 |
| InChIKey | DPESHRZSOJEKTQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |