C24H21NO4S2 — CID 24730850
1-benzofuran-5-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone (PubChem CID 24730850) has the molecular formula C24H21NO4S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-benzofuran-5-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone.
| Compound Name | 1-benzofuran-5-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 24730850 |
| Molecular Formula | C24H21NO4S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 1-benzofuran-5-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2occc2c1)N1CCC(S(=O)(=O)c2ccc(-c3ccsc3)cc2)CC1 |
| InChI | InChI=1S/C24H21NO4S2/c26-24(19-3-6-23-18(15-19)9-13-29-23)25-11-7-22(8-12-25)31(27,28)21-4-1-17(2-5-21)20-10-14-30-16-20/h1-6,9-10,13-16,22H,7-8,11-12H2 |
| InChIKey | GXGCFWIOCURLQK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |