C24H21N3O3S2 — CID 24730849
quinoxalin-2-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone (PubChem CID 24730849) has the molecular formula C24H21N3O3S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is quinoxalin-2-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone.
| Compound Name | quinoxalin-2-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 24730849 |
| Molecular Formula | C24H21N3O3S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | quinoxalin-2-yl-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]methanone |
| SMILES | O=C(c1cnc2ccccc2n1)N1CCC(S(=O)(=O)c2ccc(-c3ccsc3)cc2)CC1 |
| InChI | InChI=1S/C24H21N3O3S2/c28-24(23-15-25-21-3-1-2-4-22(21)26-23)27-12-9-20(10-13-27)32(29,30)19-7-5-17(6-8-19)18-11-14-31-16-18/h1-8,11,14-16,20H,9-10,12-13H2 |
| InChIKey | QPUUZZZPRFPQNF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |