C18H17F2NO3S — CID 90589559
(4-fluorophenyl)-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone (PubChem CID 90589559) has the molecular formula C18H17F2NO3S and a molecular weight of 365.40 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90589559 |
| Molecular Formula | C18H17F2NO3S |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (4-fluorophenyl)-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H17F2NO3S/c19-14-3-1-13(2-4-14)18(22)21-11-9-17(10-12-21)25(23,24)16-7-5-15(20)6-8-16/h1-8,17H,9-12H2 |
| InChIKey | QCDXWMNZMVTQAV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |