C18H27ClN2O3S — CID 119561781
(4-cyclopentylsulfonylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119561781) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is (4-cyclopentylsulfonylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-cyclopentylsulfonylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119561781 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (4-cyclopentylsulfonylphenyl)-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2ccc(S(=O)(=O)C3CCCC3)cc2)CC1.Cl |
| InChI | InChI=1S/C18H26N2O3S.ClH/c1-19-15-10-12-20(13-11-15)18(21)14-6-8-17(9-7-14)24(22,23)16-4-2-3-5-16;/h6-9,15-16,19H,2-5,10-13H2,1H3;1H |
| InChIKey | ANWDPIZHYPERCJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |