C27H22N2O4S — CID 24730980
4-[4-[1-(1-benzofuran-5-carbonyl)piperidin-4-yl]sulfonylphenyl]benzonitrile (PubChem CID 24730980) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-[4-[1-(1-benzofuran-5-carbonyl)piperidin-4-yl]sulfonylphenyl]benzonitrile.
| Compound Name | 4-[4-[1-(1-benzofuran-5-carbonyl)piperidin-4-yl]sulfonylphenyl]benzonitrile |
|---|---|
| PubChem CID | 24730980 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 4-[4-[1-(1-benzofuran-5-carbonyl)piperidin-4-yl]sulfonylphenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(S(=O)(=O)C3CCN(C(=O)c4ccc5occc5c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O4S/c28-18-19-1-3-20(4-2-19)21-5-8-24(9-6-21)34(31,32)25-11-14-29(15-12-25)27(30)23-7-10-26-22(17-23)13-16-33-26/h1-10,13,16-17,25H,11-12,14-15H2 |
| InChIKey | BNWQMPZUMMRKCF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |