C23H23NO3S — CID 166377497
[4-(4-methoxyphenoxy)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone (PubChem CID 166377497) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [4-(4-methoxyphenoxy)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone.
| Compound Name | [4-(4-methoxyphenoxy)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 166377497 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [4-(4-methoxyphenoxy)piperidin-1-yl]-(4-thiophen-3-ylphenyl)methanone |
| SMILES | COc1ccc(OC2CCN(C(=O)c3ccc(-c4ccsc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-26-20-6-8-21(9-7-20)27-22-10-13-24(14-11-22)23(25)18-4-2-17(3-5-18)19-12-15-28-16-19/h2-9,12,15-16,22H,10-11,13-14H2,1H3 |
| InChIKey | JLEFMFNNRFGAPB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |