C25H25NO5 — CID 90629010
4-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one (PubChem CID 90629010) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one.
| Compound Name | 4-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 90629010 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one |
| SMILES | COc1cccc(-c2ccc(C(=O)N3CCC(Oc4cc(C)oc(=O)c4)CC3)cc2)c1 |
| InChI | InChI=1S/C25H25NO5/c1-17-14-23(16-24(27)30-17)31-21-10-12-26(13-11-21)25(28)19-8-6-18(7-9-19)20-4-3-5-22(15-20)29-2/h3-9,14-16,21H,10-13H2,1-2H3 |
| InChIKey | RBWXPMPDTGXZIQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |