C20H23NO6 — CID 90628984
4-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one (PubChem CID 90628984) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one.
| Compound Name | 4-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 90628984 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(Oc3cc(C)oc(=O)c3)CC2)c1 |
| InChI | InChI=1S/C20H23NO6/c1-13-8-18(12-19(22)26-13)27-15-4-6-21(7-5-15)20(23)14-9-16(24-2)11-17(10-14)25-3/h8-12,15H,4-7H2,1-3H3 |
| InChIKey | QLDJEDROOMHZKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |