C24H21Cl2NO4 — CID 121155785
4-[1-[4-(3,4-dichlorophenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one (PubChem CID 121155785) has the molecular formula C24H21Cl2NO4 and a molecular weight of 458.34 g/mol. Its IUPAC name is 4-[1-[4-(3,4-dichlorophenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one.
| Compound Name | 4-[1-[4-(3,4-dichlorophenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 121155785 |
| Molecular Formula | C24H21Cl2NO4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 4-[1-[4-(3,4-dichlorophenyl)benzoyl]piperidin-4-yl]oxy-6-methylpyran-2-one |
| SMILES | Cc1cc(OC2CCN(C(=O)c3ccc(-c4ccc(Cl)c(Cl)c4)cc3)CC2)cc(=O)o1 |
| InChI | InChI=1S/C24H21Cl2NO4/c1-15-12-20(14-23(28)30-15)31-19-8-10-27(11-9-19)24(29)17-4-2-16(3-5-17)18-6-7-21(25)22(26)13-18/h2-7,12-14,19H,8-11H2,1H3 |
| InChIKey | QIXFUKQDYIQWHE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |