C22H28N2O4S — CID 90631400
7-(2-methylphenyl)-N-(3,4,5-trimethoxyphenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90631400) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 7-(2-methylphenyl)-N-(3,4,5-trimethoxyphenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(2-methylphenyl)-N-(3,4,5-trimethoxyphenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90631400 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 7-(2-methylphenyl)-N-(3,4,5-trimethoxyphenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCSC(c3ccccc3C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H28N2O4S/c1-15-7-5-6-8-17(15)20-9-10-24(11-12-29-20)22(25)23-16-13-18(26-2)21(28-4)19(14-16)27-3/h5-8,13-14,20H,9-12H2,1-4H3,(H,23,25) |
| InChIKey | OSCASJNVCBVWBB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |