C18H18BrNO4S — CID 97354905
[(3S)-3-(benzenesulfonyl)pyrrolidin-1-yl]-(2-bromo-5-methoxyphenyl)methanone (PubChem CID 97354905) has the molecular formula C18H18BrNO4S and a molecular weight of 424.32 g/mol. Its IUPAC name is [(3S)-3-(benzenesulfonyl)pyrrolidin-1-yl]-(2-bromo-5-methoxyphenyl)methanone.
| Compound Name | [(3S)-3-(benzenesulfonyl)pyrrolidin-1-yl]-(2-bromo-5-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 97354905 |
| Molecular Formula | C18H18BrNO4S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | [(3S)-3-(benzenesulfonyl)pyrrolidin-1-yl]-(2-bromo-5-methoxyphenyl)methanone |
| SMILES | COc1ccc(Br)c(C(=O)N2CC[C@H](S(=O)(=O)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C18H18BrNO4S/c1-24-13-7-8-17(19)16(11-13)18(21)20-10-9-15(12-20)25(22,23)14-5-3-2-4-6-14/h2-8,11,15H,9-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | GPLRYNVHHQHEDK-HNNXBMFYSA-N |
| XLogP | 3.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |