C18H18BrNO5S — CID 90593364
(2-bromo-5-methoxyphenyl)-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone (PubChem CID 90593364) has the molecular formula C18H18BrNO5S and a molecular weight of 440.32 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone |
|---|---|
| PubChem CID | 90593364 |
| Molecular Formula | C18H18BrNO5S |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)C2CN(C(=O)c3cc(OC)ccc3Br)C2)cc1 |
| InChI | InChI=1S/C18H18BrNO5S/c1-24-12-3-6-14(7-4-12)26(22,23)15-10-20(11-15)18(21)16-9-13(25-2)5-8-17(16)19/h3-9,15H,10-11H2,1-2H3 |
| InChIKey | NXIMNBFSQMWPIU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |