C24H20N2O4S — CID 90593374
acridin-9-yl-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone (PubChem CID 90593374) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is acridin-9-yl-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone.
| Compound Name | acridin-9-yl-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone |
|---|---|
| PubChem CID | 90593374 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | acridin-9-yl-[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)C2CN(C(=O)c3c4ccccc4nc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C24H20N2O4S/c1-30-16-10-12-17(13-11-16)31(28,29)18-14-26(15-18)24(27)23-19-6-2-4-8-21(19)25-22-9-5-3-7-20(22)23/h2-13,18H,14-15H2,1H3 |
| InChIKey | ASQOLUUJHFMNMH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|