C18H17BrClNO4S — CID 90587636
(2-bromo-5-methoxyphenyl)-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]methanone (PubChem CID 90587636) has the molecular formula C18H17BrClNO4S and a molecular weight of 458.76 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 90587636 |
| Molecular Formula | C18H17BrClNO4S |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(Br)c(C(=O)N2CCC(S(=O)(=O)c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C18H17BrClNO4S/c1-25-13-4-7-17(19)16(10-13)18(22)21-9-8-15(11-21)26(23,24)14-5-2-12(20)3-6-14/h2-7,10,15H,8-9,11H2,1H3 |
| InChIKey | CZTXYTMSKWCINN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |