C22H21NO6S — CID 90591754
3-[4-(4-methoxyphenyl)sulfonylpiperidine-1-carbonyl]chromen-2-one (PubChem CID 90591754) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)sulfonylpiperidine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-(4-methoxyphenyl)sulfonylpiperidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 90591754 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)sulfonylpiperidine-1-carbonyl]chromen-2-one |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(C(=O)c3cc4ccccc4oc3=O)CC2)cc1 |
| InChI | InChI=1S/C22H21NO6S/c1-28-16-6-8-17(9-7-16)30(26,27)18-10-12-23(13-11-18)21(24)19-14-15-4-2-3-5-20(15)29-22(19)25/h2-9,14,18H,10-13H2,1H3 |
| InChIKey | SIHVAHRADRMHCO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|