C16H15ClN2O3S2 — CID 90632699
(5-chloro-2-nitrophenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone (PubChem CID 90632699) has the molecular formula C16H15ClN2O3S2 and a molecular weight of 382.89 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone.
| Compound Name | (5-chloro-2-nitrophenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 90632699 |
| Molecular Formula | C16H15ClN2O3S2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (5-chloro-2-nitrophenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C16H15ClN2O3S2/c17-11-3-4-13(19(21)22)12(10-11)16(20)18-6-5-15(24-9-7-18)14-2-1-8-23-14/h1-4,8,10,15H,5-7,9H2 |
| InChIKey | GKLAHQXNJANOFL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|