C19H17ClN2O5S — CID 90630640
[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-chloro-2-nitrophenyl)methanone (PubChem CID 90630640) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-chloro-2-nitrophenyl)methanone.
| Compound Name | [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-chloro-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90630640 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-chloro-2-nitrophenyl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H17ClN2O5S/c20-13-2-3-15(22(24)25)14(10-13)19(23)21-6-5-18(28-8-7-21)12-1-4-16-17(9-12)27-11-26-16/h1-4,9-10,18H,5-8,11H2 |
| InChIKey | IHRWGTJZANNRPH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|