C19H19ClN2O3S — CID 90630892
7-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90630892) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90630892 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H19ClN2O3S/c20-14-2-4-15(5-3-14)21-19(23)22-8-7-18(26-10-9-22)13-1-6-16-17(11-13)25-12-24-16/h1-6,11,18H,7-10,12H2,(H,21,23) |
| InChIKey | SHSUFYCJRZSXQU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |