C17H16N2O6S — CID 90630712
[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 90630712) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 90630712 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H16N2O6S/c20-17(13-3-4-16(25-13)19(21)22)18-6-5-15(26-8-7-18)11-1-2-12-14(9-11)24-10-23-12/h1-4,9,15H,5-8,10H2 |
| InChIKey | PJCZYWHCRPCIKO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|