C18H18N2O4S — CID 90630525
5-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepane-4-carbonyl]-1H-pyridin-2-one (PubChem CID 90630525) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepane-4-carbonyl]-1H-pyridin-2-one.
| Compound Name | 5-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepane-4-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 90630525 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepane-4-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(=O)[nH]c1)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H18N2O4S/c21-17-4-2-13(10-19-17)18(22)20-6-5-16(25-8-7-20)12-1-3-14-15(9-12)24-11-23-14/h1-4,9-10,16H,5-8,11H2,(H,19,21) |
| InChIKey | KDWMUZSOWGSCAG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |