C27H27NO3S — CID 121163684
1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-3,3-diphenylpropan-1-one (PubChem CID 121163684) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 121163684 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-3,3-diphenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C27H27NO3S/c29-27(18-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21)28-14-13-26(32-16-15-28)22-11-12-24-25(17-22)31-19-30-24/h1-12,17,23,26H,13-16,18-19H2 |
| InChIKey | HBKHKAGFWUVELM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |