C15H19NO3S — CID 90630573
1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]propan-1-one (PubChem CID 90630573) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]propan-1-one.
| Compound Name | 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 90630573 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]propan-1-one |
| SMILES | CCC(=O)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H19NO3S/c1-2-15(17)16-6-5-14(20-8-7-16)11-3-4-12-13(9-11)19-10-18-12/h3-4,9,14H,2,5-8,10H2,1H3 |
| InChIKey | INENSXZABQZPEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |