C20H23NO3S — CID 90630802
[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone (PubChem CID 90630802) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone.
| Compound Name | [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone |
|---|---|
| PubChem CID | 90630802 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone |
| SMILES | O=C(C1CC2C=CC1C2)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H23NO3S/c22-20(16-10-13-1-2-14(16)9-13)21-6-5-19(25-8-7-21)15-3-4-17-18(11-15)24-12-23-17/h1-4,11,13-14,16,19H,5-10,12H2 |
| InChIKey | QALVCKKXDMKXRS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|