C17H21NOS2 — CID 90632868
2-bicyclo[2.2.1]hept-5-enyl-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone (PubChem CID 90632868) has the molecular formula C17H21NOS2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 90632868 |
| Molecular Formula | C17H21NOS2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(C1CC2C=CC1C2)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C17H21NOS2/c19-17(14-11-12-3-4-13(14)10-12)18-6-5-16(21-9-7-18)15-2-1-8-20-15/h1-4,8,12-14,16H,5-7,9-11H2 |
| InChIKey | BLDGKKFYKAAIKI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|