C17H16N2OS2 — CID 90632812
4-(7-thiophen-2-yl-1,4-thiazepane-4-carbonyl)benzonitrile (PubChem CID 90632812) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(7-thiophen-2-yl-1,4-thiazepane-4-carbonyl)benzonitrile.
| Compound Name | 4-(7-thiophen-2-yl-1,4-thiazepane-4-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 90632812 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-(7-thiophen-2-yl-1,4-thiazepane-4-carbonyl)benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCSC(c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C17H16N2OS2/c18-12-13-3-5-14(6-4-13)17(20)19-8-7-16(22-11-9-19)15-2-1-10-21-15/h1-6,10,16H,7-9,11H2 |
| InChIKey | QXNTUFURPSTDOX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |