C16H16N2O2S3 — CID 90633110
4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzonitrile (PubChem CID 90633110) has the molecular formula C16H16N2O2S3 and a molecular weight of 364.52 g/mol. Its IUPAC name is 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzonitrile.
| Compound Name | 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 90633110 |
| Molecular Formula | C16H16N2O2S3 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCSC(c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C16H16N2O2S3/c17-12-13-3-5-14(6-4-13)23(19,20)18-8-7-16(22-11-9-18)15-2-1-10-21-15/h1-6,10,16H,7-9,11H2 |
| InChIKey | BQLQBTQFOMCWAI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |