C17H19NO4S3 — CID 90633090
methyl 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzoate (PubChem CID 90633090) has the molecular formula C17H19NO4S3 and a molecular weight of 397.54 g/mol. Its IUPAC name is methyl 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzoate.
| Compound Name | methyl 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 90633090 |
| Molecular Formula | C17H19NO4S3 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | methyl 4-[(7-thiophen-2-yl-1,4-thiazepan-4-yl)sulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCSC(c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C17H19NO4S3/c1-22-17(19)13-4-6-14(7-5-13)25(20,21)18-9-8-16(24-12-10-18)15-3-2-11-23-15/h2-7,11,16H,8-10,12H2,1H3 |
| InChIKey | UEXIBUOGHZIMQM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |