C19H20FNO4S2 — CID 90630467
methyl 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]benzoate (PubChem CID 90630467) has the molecular formula C19H20FNO4S2 and a molecular weight of 409.50 g/mol. Its IUPAC name is methyl 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]benzoate.
| Compound Name | methyl 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 90630467 |
| Molecular Formula | C19H20FNO4S2 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCSC(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H20FNO4S2/c1-25-19(22)14-6-8-15(9-7-14)27(23,24)21-11-10-18(26-13-12-21)16-4-2-3-5-17(16)20/h2-9,18H,10-13H2,1H3 |
| InChIKey | AWDLKPBLYYYEQX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |