C18H19F2NO2S2 — CID 90631938
7-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonyl-1,4-thiazepane (PubChem CID 90631938) has the molecular formula C18H19F2NO2S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 7-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 7-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90631938 |
| Molecular Formula | C18H19F2NO2S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 7-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonyl-1,4-thiazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCSC(c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C18H19F2NO2S2/c1-13-2-5-15(6-3-13)25(22,23)21-9-8-18(24-11-10-21)16-12-14(19)4-7-17(16)20/h2-7,12,18H,8-11H2,1H3 |
| InChIKey | XVCDYMMODLFMMM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |