C17H16ClF2NO2S — CID 23028687
1-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)piperidine (PubChem CID 23028687) has the molecular formula C17H16ClF2NO2S and a molecular weight of 371.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)piperidine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)piperidine |
|---|---|
| PubChem CID | 23028687 |
| Molecular Formula | C17H16ClF2NO2S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)piperidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H16ClF2NO2S/c18-13-1-4-15(5-2-13)24(22,23)21-9-7-12(8-10-21)16-11-14(19)3-6-17(16)20/h1-6,11-12H,7-10H2 |
| InChIKey | GAFTZSOZOBJXSO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |