C14H15FN2O3S2 — CID 90630510
4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]-1,2-oxazole (PubChem CID 90630510) has the molecular formula C14H15FN2O3S2 and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]-1,2-oxazole.
| Compound Name | 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]-1,2-oxazole |
|---|---|
| PubChem CID | 90630510 |
| Molecular Formula | C14H15FN2O3S2 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-[[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]sulfonyl]-1,2-oxazole |
| SMILES | O=S(=O)(c1cnoc1)N1CCSC(c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H15FN2O3S2/c15-13-4-2-1-3-12(13)14-5-6-17(7-8-21-14)22(18,19)11-9-16-20-10-11/h1-4,9-10,14H,5-8H2 |
| InChIKey | JIGNMDGHTXSVBO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |