C18H19ClFNO2S2 — CID 124670926
(7R)-4-[(4-chlorophenyl)methylsulfonyl]-7-(2-fluorophenyl)-1,4-thiazepane (PubChem CID 124670926) has the molecular formula C18H19ClFNO2S2 and a molecular weight of 399.94 g/mol. Its IUPAC name is (7R)-4-[(4-chlorophenyl)methylsulfonyl]-7-(2-fluorophenyl)-1,4-thiazepane.
| Compound Name | (7R)-4-[(4-chlorophenyl)methylsulfonyl]-7-(2-fluorophenyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 124670926 |
| Molecular Formula | C18H19ClFNO2S2 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | (7R)-4-[(4-chlorophenyl)methylsulfonyl]-7-(2-fluorophenyl)-1,4-thiazepane |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)N1CCS[C@@H](c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H19ClFNO2S2/c19-15-7-5-14(6-8-15)13-25(22,23)21-10-9-18(24-12-11-21)16-3-1-2-4-17(16)20/h1-8,18H,9-13H2/t18-/m1/s1 |
| InChIKey | VRDOCSBBCGAPRW-GOSISDBHSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |