C19H21NO4S2 — CID 90630971
7-(1,3-benzodioxol-5-yl)-4-benzylsulfonyl-1,4-thiazepane (PubChem CID 90630971) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-4-benzylsulfonyl-1,4-thiazepane.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-4-benzylsulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90630971 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-4-benzylsulfonyl-1,4-thiazepane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H21NO4S2/c21-26(22,13-15-4-2-1-3-5-15)20-9-8-19(25-11-10-20)16-6-7-17-18(12-16)24-14-23-17/h1-7,12,19H,8-11,13-14H2 |
| InChIKey | SBZKYFOCWOQTDF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |