C18H17F2NO4S2 — CID 90631021
7-(1,3-benzodioxol-5-yl)-4-(3,4-difluorophenyl)sulfonyl-1,4-thiazepane (PubChem CID 90631021) has the molecular formula C18H17F2NO4S2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-4-(3,4-difluorophenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-4-(3,4-difluorophenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90631021 |
| Molecular Formula | C18H17F2NO4S2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-4-(3,4-difluorophenyl)sulfonyl-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H17F2NO4S2/c19-14-3-2-13(10-15(14)20)27(22,23)21-6-5-18(26-8-7-21)12-1-4-16-17(9-12)25-11-24-16/h1-4,9-10,18H,5-8,11H2 |
| InChIKey | PJJUSRASVIONCR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |