C18H18N2O6S2 — CID 90630983
7-(1,3-benzodioxol-5-yl)-4-(3-nitrophenyl)sulfonyl-1,4-thiazepane (PubChem CID 90630983) has the molecular formula C18H18N2O6S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-4-(3-nitrophenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-4-(3-nitrophenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90630983 |
| Molecular Formula | C18H18N2O6S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-4-(3-nitrophenyl)sulfonyl-1,4-thiazepane |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCSC(c3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C18H18N2O6S2/c21-20(22)14-2-1-3-15(11-14)28(23,24)19-7-6-18(27-9-8-19)13-4-5-16-17(10-13)26-12-25-16/h1-5,10-11,18H,6-9,12H2 |
| InChIKey | LUAMTOJFXPEIOA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|