C15H21NO4S2 — CID 90631000
7-(1,3-benzodioxol-5-yl)-4-propan-2-ylsulfonyl-1,4-thiazepane (PubChem CID 90631000) has the molecular formula C15H21NO4S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-4-propan-2-ylsulfonyl-1,4-thiazepane.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-4-propan-2-ylsulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90631000 |
| Molecular Formula | C15H21NO4S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-4-propan-2-ylsulfonyl-1,4-thiazepane |
| SMILES | CC(C)S(=O)(=O)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H21NO4S2/c1-11(2)22(17,18)16-6-5-15(21-8-7-16)12-3-4-13-14(9-12)20-10-19-13/h3-4,9,11,15H,5-8,10H2,1-2H3 |
| InChIKey | BZJJDGWHRKIQGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |