About 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane
7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane (PubChem CID 90631034) has the molecular formula C16H19N3O4S2
and a molecular weight of 381.48 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane |
| PubChem CID | 90631034 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane |
| SMILES | Cn1cnc(S(=O)(=O)N2CCSC(c3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-18-9-16(17-10-18)25(20,21)19-5-4-15(24-7-6-19)12-2-3-13-14(8-12)23-11-22-13/h2-3,8-10,15H,4-7,11H2,1H3 |
| InChIKey | AXDZAHSDMWXOKK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane?
The IUPAC name of 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane (CID 90631034) is 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane.
What is the SMILES notation for 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane?
The canonical SMILES for 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane is Cn1cnc(S(=O)(=O)N2CCSC(c3ccc4c(c3)OCO4)CC2)c1.
What is the InChIKey of 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane?
The InChIKey is AXDZAHSDMWXOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4S2/c1-18-9-16(17-10-18)25(20,21)19-5-4-15(24-7-6-19)12-2-3-13-14(8-12)23-11-22-13/h2-3,8-10,15H,4-7,11H2,1H3.
What are the key properties of 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane?
7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane has a molecular weight of 381.48 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-benzodioxol-5-yl)-4-(1-methylimidazol-4-yl)sulfonyl-1,4-thiazepane is sourced from PubChem (CID 90631034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).