C16H18FNO2S3 — CID 90633133
4-(4-fluoro-2-methylphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane (PubChem CID 90633133) has the molecular formula C16H18FNO2S3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane.
| Compound Name | 4-(4-fluoro-2-methylphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 90633133 |
| Molecular Formula | C16H18FNO2S3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-(4-fluoro-2-methylphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C16H18FNO2S3/c1-12-11-13(17)4-5-16(12)23(19,20)18-7-6-15(22-10-8-18)14-3-2-9-21-14/h2-5,9,11,15H,6-8,10H2,1H3 |
| InChIKey | MZGCZKUEAYMHSA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |