C23H23NOS2 — CID 90632738
2,2-diphenyl-1-(7-thiophen-2-yl-1,4-thiazepan-4-yl)ethanone (PubChem CID 90632738) has the molecular formula C23H23NOS2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 2,2-diphenyl-1-(7-thiophen-2-yl-1,4-thiazepan-4-yl)ethanone.
| Compound Name | 2,2-diphenyl-1-(7-thiophen-2-yl-1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 90632738 |
| Molecular Formula | C23H23NOS2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2,2-diphenyl-1-(7-thiophen-2-yl-1,4-thiazepan-4-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C23H23NOS2/c25-23(24-14-13-21(27-17-15-24)20-12-7-16-26-20)22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-12,16,21-22H,13-15,17H2 |
| InChIKey | XGGSENSSMQNOEU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |