C16H24N2OS2 — CID 90632960
N-cyclohexyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide (PubChem CID 90632960) has the molecular formula C16H24N2OS2 and a molecular weight of 324.52 g/mol. Its IUPAC name is N-cyclohexyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide.
| Compound Name | N-cyclohexyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90632960 |
| Molecular Formula | C16H24N2OS2 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-cyclohexyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C16H24N2OS2/c19-16(17-13-5-2-1-3-6-13)18-9-8-15(21-12-10-18)14-7-4-11-20-14/h4,7,11,13,15H,1-3,5-6,8-10,12H2,(H,17,19) |
| InChIKey | QRTUFELJECTPJS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |