C13H20N2OS2 — CID 90633001
N-propan-2-yl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide (PubChem CID 90633001) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-propan-2-yl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide.
| Compound Name | N-propan-2-yl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90633001 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-propan-2-yl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
| SMILES | CC(C)NC(=O)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C13H20N2OS2/c1-10(2)14-13(16)15-6-5-12(18-9-7-15)11-4-3-8-17-11/h3-4,8,10,12H,5-7,9H2,1-2H3,(H,14,16) |
| InChIKey | SNBFMUAVTUSTTM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |