C14H22N2OS2 — CID 90633015
N,N-diethyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide (PubChem CID 90633015) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is N,N-diethyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide.
| Compound Name | N,N-diethyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90633015 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N,N-diethyl-7-thiophen-2-yl-1,4-thiazepane-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCSC(c2cccs2)CC1 |
| InChI | InChI=1S/C14H22N2OS2/c1-3-15(4-2)14(17)16-8-7-13(19-11-9-16)12-6-5-10-18-12/h5-6,10,13H,3-4,7-9,11H2,1-2H3 |
| InChIKey | OUQLJHLZPJTQQA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |