C19H16F2N2OS — CID 90631757
4-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]benzonitrile (PubChem CID 90631757) has the molecular formula C19H16F2N2OS and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]benzonitrile.
| Compound Name | 4-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 90631757 |
| Molecular Formula | C19H16F2N2OS |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCSC(c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H16F2N2OS/c20-15-5-6-17(21)16(11-15)18-7-8-23(9-10-25-18)19(24)14-3-1-13(12-22)2-4-14/h1-6,11,18H,7-10H2 |
| InChIKey | PGDYQXQFNRLNJH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |