C20H18F2N2OS — CID 90631778
[7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(1H-indol-6-yl)methanone (PubChem CID 90631778) has the molecular formula C20H18F2N2OS and a molecular weight of 372.44 g/mol. Its IUPAC name is [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(1H-indol-6-yl)methanone.
| Compound Name | [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(1H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 90631778 |
| Molecular Formula | C20H18F2N2OS |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [7-(2,5-difluorophenyl)-1,4-thiazepan-4-yl]-(1H-indol-6-yl)methanone |
| SMILES | O=C(c1ccc2cc[nH]c2c1)N1CCSC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H18F2N2OS/c21-15-3-4-17(22)16(12-15)19-6-8-24(9-10-26-19)20(25)14-2-1-13-5-7-23-18(13)11-14/h1-5,7,11-12,19,23H,6,8-10H2 |
| InChIKey | AYIMLIKJWLJHQT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |