C16H18F2N2O2S — CID 90631559
5-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]pyrrolidin-2-one (PubChem CID 90631559) has the molecular formula C16H18F2N2O2S and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]pyrrolidin-2-one.
| Compound Name | 5-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90631559 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 5-[7-(2,5-difluorophenyl)-1,4-thiazepane-4-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(C(=O)N2CCSC(c3cc(F)ccc3F)CC2)N1 |
| InChI | InChI=1S/C16H18F2N2O2S/c17-10-1-2-12(18)11(9-10)14-5-6-20(7-8-23-14)16(22)13-3-4-15(21)19-13/h1-2,9,13-14H,3-8H2,(H,19,21) |
| InChIKey | HNDFZOURQXJRLK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |