C20H21NO4 — CID 45197792
3-(1,3-benzodioxol-5-yl)-1-morpholin-4-yl-3-phenylpropan-1-one (PubChem CID 45197792) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-morpholin-4-yl-3-phenylpropan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-morpholin-4-yl-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 45197792 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-morpholin-4-yl-3-phenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccc2c(c1)OCO2)N1CCOCC1 |
| InChI | InChI=1S/C20H21NO4/c22-20(21-8-10-23-11-9-21)13-17(15-4-2-1-3-5-15)16-6-7-18-19(12-16)25-14-24-18/h1-7,12,17H,8-11,13-14H2 |
| InChIKey | MESYPZAHRGEAED-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |