C22H25NO3 — CID 26333026
(3R)-1-(azepan-1-yl)-3-(1,3-benzodioxol-5-yl)-3-phenylpropan-1-one (PubChem CID 26333026) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3R)-1-(azepan-1-yl)-3-(1,3-benzodioxol-5-yl)-3-phenylpropan-1-one.
| Compound Name | (3R)-1-(azepan-1-yl)-3-(1,3-benzodioxol-5-yl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 26333026 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3R)-1-(azepan-1-yl)-3-(1,3-benzodioxol-5-yl)-3-phenylpropan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)c1ccc2c(c1)OCO2)N1CCCCCC1 |
| InChI | InChI=1S/C22H25NO3/c24-22(23-12-6-1-2-7-13-23)15-19(17-8-4-3-5-9-17)18-10-11-20-21(14-18)26-16-25-20/h3-5,8-11,14,19H,1-2,6-7,12-13,15-16H2/t19-/m1/s1 |
| InChIKey | UBWHLRKDXSPNMX-LJQANCHMSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |