C16H25N3O4 — CID 9281878
ethyl 1-[[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 9281878) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 1-[[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9281878 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | ethyl 1-[[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CN2C(=O)N[C@](C)(C3CC3)C2=O)CC1 |
| InChI | InChI=1S/C16H25N3O4/c1-3-23-13(20)11-6-8-18(9-7-11)10-19-14(21)16(2,12-4-5-12)17-15(19)22/h11-12H,3-10H2,1-2H3,(H,17,22)/t16-/m1/s1 |
| InChIKey | FKTOZRLGRYKJJB-MRXNPFEDSA-N |
| XLogP | 0.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|